C27H34N10O2 — CID 172972195
2-[3-aminobut-3-enyl-[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide;2-[bis(2-cyanoethyl)amino]benzonitrile (PubChem CID 172972195) has the molecular formula C27H34N10O2 and a molecular weight of 530.64 g/mol. Its IUPAC name is 2-[3-aminobut-3-enyl-[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide;2-[bis(2-cyanoethyl)amino]benzonitrile.
| Compound Name | 2-[3-aminobut-3-enyl-[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide;2-[bis(2-cyanoethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 172972195 |
| Molecular Formula | C27H34N10O2 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 2-[3-aminobut-3-enyl-[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide;2-[bis(2-cyanoethyl)amino]benzonitrile |
| SMILES | C=C(N)CCN(CC/C(N)=N/O)c1ccccc1/C(N)=N/O.N#CCCN(CCC#N)c1ccccc1C#N |
| InChI | InChI=1S/C14H22N6O2.C13H12N4/c1-10(15)6-8-20(9-7-13(16)18-21)12-5-3-2-4-11(12)14(17)19-22;14-7-3-9-17(10-4-8-15)13-6-2-1-5-12(13)11-16/h2-5,21-22H,1,6-9,15H2,(H2,16,18)(H2,17,19);1-2,5-6H,3-4,9-10H2 |
| InChIKey | FFVAKEOUORSQAY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 221.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|