C13H21N7O3 — CID 173487868
2-[bis[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 173487868) has the molecular formula C13H21N7O3 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-[bis[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[bis[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 173487868 |
| Molecular Formula | C13H21N7O3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[bis[(3Z)-3-amino-3-hydroxyiminopropyl]amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(CCN(CC/C(N)=N/O)c1ccccc1/C(N)=N/O)=N\O |
| InChI | InChI=1S/C13H21N7O3/c14-11(17-21)5-7-20(8-6-12(15)18-22)10-4-2-1-3-9(10)13(16)19-23/h1-4,21-23H,5-8H2,(H2,14,17)(H2,15,18)(H2,16,19) |
| InChIKey | KKSGIBPWQUIDBD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 179.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|