C14H15N7O2 — CID 172972245
(1Z)-N-[[2-[C-(3-amino-1H-1,2,4-triazol-5-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]ethanimidoyl cyanide (PubChem CID 172972245) has the molecular formula C14H15N7O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is (1Z)-N-[[2-[C-(3-amino-1H-1,2,4-triazol-5-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]ethanimidoyl cyanide.
| Compound Name | (1Z)-N-[[2-[C-(3-amino-1H-1,2,4-triazol-5-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172972245 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (1Z)-N-[[2-[C-(3-amino-1H-1,2,4-triazol-5-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]ethanimidoyl cyanide |
| SMILES | CON=C(c1nc(N)n[nH]1)c1ccccc1CO/N=C(/C)C#N |
| InChI | InChI=1S/C14H15N7O2/c1-9(7-15)20-23-8-10-5-3-4-6-11(10)12(21-22-2)13-17-14(16)19-18-13/h3-6H,8H2,1-2H3,(H3,16,17,18,19)/b20-9-,21-12? |
| InChIKey | FGLMFRFMJVEQNS-VPXBZODUSA-N |
| XLogP | 1.20 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|