C18H16ClN3O3 — CID 54395015
1-[2-[(4-chlorophenoxy)methyl]phenyl]-N-methoxy-1-(5-methyl-1,2,4-oxadiazol-3-yl)methanimine (PubChem CID 54395015) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenoxy)methyl]phenyl]-N-methoxy-1-(5-methyl-1,2,4-oxadiazol-3-yl)methanimine.
| Compound Name | 1-[2-[(4-chlorophenoxy)methyl]phenyl]-N-methoxy-1-(5-methyl-1,2,4-oxadiazol-3-yl)methanimine |
|---|---|
| PubChem CID | 54395015 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-[2-[(4-chlorophenoxy)methyl]phenyl]-N-methoxy-1-(5-methyl-1,2,4-oxadiazol-3-yl)methanimine |
| SMILES | CON=C(c1noc(C)n1)c1ccccc1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-12-20-18(22-25-12)17(21-23-2)16-6-4-3-5-13(16)11-24-15-9-7-14(19)8-10-15/h3-10H,11H2,1-2H3 |
| InChIKey | VJICUVFIQKXXFJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|