C36H36N4O4S2 — CID 172972681
(4-ethenylphenyl)methyl 2-[(Z)-[(4-methylsulfanylphenyl)-morpholin-4-ylmethylidene]amino]oxyacetate;3-phenyl-1H-benzimidazole-2-thione (PubChem CID 172972681) has the molecular formula C36H36N4O4S2 and a molecular weight of 652.84 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 2-[(Z)-[(4-methylsulfanylphenyl)-morpholin-4-ylmethylidene]amino]oxyacetate;3-phenyl-1H-benzimidazole-2-thione.
| Compound Name | (4-ethenylphenyl)methyl 2-[(Z)-[(4-methylsulfanylphenyl)-morpholin-4-ylmethylidene]amino]oxyacetate;3-phenyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 172972681 |
| Molecular Formula | C36H36N4O4S2 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | (4-ethenylphenyl)methyl 2-[(Z)-[(4-methylsulfanylphenyl)-morpholin-4-ylmethylidene]amino]oxyacetate;3-phenyl-1H-benzimidazole-2-thione |
| SMILES | C=Cc1ccc(COC(=O)CO/N=C(/c2ccc(SC)cc2)N2CCOCC2)cc1.S=c1[nH]c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H26N2O4S.C13H10N2S/c1-3-18-4-6-19(7-5-18)16-28-22(26)17-29-24-23(25-12-14-27-15-13-25)20-8-10-21(30-2)11-9-20;16-13-14-11-8-4-5-9-12(11)15(13)10-6-2-1-3-7-10/h3-11H,1,12-17H2,2H3;1-9H,(H,14,16)/b24-23-; |
| InChIKey | IEFFNRKXDGTMPN-DCXSSQDFSA-N |
| XLogP | 7.49 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|