C24H28N2O4S — CID 20789654
(4-ethenylphenyl)methyl 2-[(Z)-[1-(4-methylsulfanylphenyl)-2-morpholin-4-ylethylidene]amino]oxyacetate (PubChem CID 20789654) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 2-[(Z)-[1-(4-methylsulfanylphenyl)-2-morpholin-4-ylethylidene]amino]oxyacetate.
| Compound Name | (4-ethenylphenyl)methyl 2-[(Z)-[1-(4-methylsulfanylphenyl)-2-morpholin-4-ylethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 20789654 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (4-ethenylphenyl)methyl 2-[(Z)-[1-(4-methylsulfanylphenyl)-2-morpholin-4-ylethylidene]amino]oxyacetate |
| SMILES | C=Cc1ccc(COC(=O)CO/N=C(\CN2CCOCC2)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O4S/c1-3-19-4-6-20(7-5-19)17-29-24(27)18-30-25-23(16-26-12-14-28-15-13-26)21-8-10-22(31-2)11-9-21/h3-11H,1,12-18H2,2H3/b25-23+ |
| InChIKey | SNMFHWQTBQSDNZ-WJTDDFOZSA-N |
| XLogP | 3.85 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|