C29H34F6N4O5 — CID 90033726
2-[4-[(Z)-N-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-C-(morpholin-4-ylmethyl)carbonimidoyl]phenoxy]-N-(1-methylpiperidin-4-yl)oxyacetamide (PubChem CID 90033726) has the molecular formula C29H34F6N4O5 and a molecular weight of 632.60 g/mol. Its IUPAC name is 2-[4-[(Z)-N-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-C-(morpholin-4-ylmethyl)carbonimidoyl]phenoxy]-N-(1-methylpiperidin-4-yl)oxyacetamide.
| Compound Name | 2-[4-[(Z)-N-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-C-(morpholin-4-ylmethyl)carbonimidoyl]phenoxy]-N-(1-methylpiperidin-4-yl)oxyacetamide |
|---|---|
| PubChem CID | 90033726 |
| Molecular Formula | C29H34F6N4O5 |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | 2-[4-[(Z)-N-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-C-(morpholin-4-ylmethyl)carbonimidoyl]phenoxy]-N-(1-methylpiperidin-4-yl)oxyacetamide |
| SMILES | CN1CCC(ONC(=O)COc2ccc(/C(CN3CCOCC3)=N/OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C29H34F6N4O5/c1-38-8-6-25(7-9-38)44-37-27(40)19-42-24-4-2-21(3-5-24)26(17-39-10-12-41-13-11-39)36-43-18-20-14-22(28(30,31)32)16-23(15-20)29(33,34)35/h2-5,14-16,25H,6-13,17-19H2,1H3,(H,37,40)/b36-26+ |
| InChIKey | FTOKPXMRPNEPHR-LZBRRTOVSA-N |
| XLogP | 4.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|