C15H22ClN5O2 — CID 172973362
tert-butyl 3-[(E)-[(6-chloropyrazin-2-yl)hydrazinylidene]methyl]piperidine-1-carboxylate (PubChem CID 172973362) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is tert-butyl 3-[(E)-[(6-chloropyrazin-2-yl)hydrazinylidene]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-[(6-chloropyrazin-2-yl)hydrazinylidene]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172973362 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl 3-[(E)-[(6-chloropyrazin-2-yl)hydrazinylidene]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(/C=N/Nc2cncc(Cl)n2)C1 |
| InChI | InChI=1S/C15H22ClN5O2/c1-15(2,3)23-14(22)21-6-4-5-11(10-21)7-18-20-13-9-17-8-12(16)19-13/h7-9,11H,4-6,10H2,1-3H3,(H,19,20)/b18-7+ |
| InChIKey | SFWCGERLWZCMLH-CNHKJKLMSA-N |
| XLogP | 3.17 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|