C22H31N5O3 — CID 172973820
4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;2-(4-isocyanophenoxy)-N,N-dimethylethanamine (PubChem CID 172973820) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;2-(4-isocyanophenoxy)-N,N-dimethylethanamine.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;2-(4-isocyanophenoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 172973820 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;2-(4-isocyanophenoxy)-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(/C(N)=N\O)cc1.[C-]#[N+]c1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C11H17N3O2.C11H14N2O/c1-14(2)7-8-16-10-5-3-9(4-6-10)11(12)13-15;1-12-10-4-6-11(7-5-10)14-9-8-13(2)3/h3-6,15H,7-8H2,1-2H3,(H2,12,13);4-7H,8-9H2,2-3H3 |
| InChIKey | YFSKCHSWPYYSIE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|