C16H10Cl2N6O — CID 172978735
(1Z)-2-amino-N-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-iminoethanimidoyl cyanide (PubChem CID 172978735) has the molecular formula C16H10Cl2N6O and a molecular weight of 373.20 g/mol. Its IUPAC name is (1Z)-2-amino-N-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978735 |
| Molecular Formula | C16H10Cl2N6O |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (1Z)-2-amino-N-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2oc(-c3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C16H10Cl2N6O/c17-8-1-3-10(11(18)5-8)16-22-12-6-9(2-4-14(12)25-16)23-24-13(7-19)15(20)21/h1-6,23H,(H3,20,21)/b24-13+ |
| InChIKey | NLBNPXXFLRGAHU-ZMOGYAJESA-N |
| XLogP | 4.03 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|