C14H11Cl3N2S — CID 17298385
1-(3-methylphenyl)-3-(2,4,5-trichlorophenyl)thiourea (PubChem CID 17298385) has the molecular formula C14H11Cl3N2S and a molecular weight of 345.68 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(2,4,5-trichlorophenyl)thiourea.
| Compound Name | 1-(3-methylphenyl)-3-(2,4,5-trichlorophenyl)thiourea |
|---|---|
| PubChem CID | 17298385 |
| Molecular Formula | C14H11Cl3N2S |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1-(3-methylphenyl)-3-(2,4,5-trichlorophenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl3N2S/c1-8-3-2-4-9(5-8)18-14(20)19-13-7-11(16)10(15)6-12(13)17/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | BLMCPSXRWWDQIW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|