C23H30ClN7O2 — CID 172986304
N'-[[5-chloro-2-[(E)-3-oxo-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]prop-1-enyl]phenyl]methyl-(methylideneamino)amino]ethanimidamide (PubChem CID 172986304) has the molecular formula C23H30ClN7O2 and a molecular weight of 471.99 g/mol. Its IUPAC name is N'-[[5-chloro-2-[(E)-3-oxo-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]prop-1-enyl]phenyl]methyl-(methylideneamino)amino]ethanimidamide.
| Compound Name | N'-[[5-chloro-2-[(E)-3-oxo-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]prop-1-enyl]phenyl]methyl-(methylideneamino)amino]ethanimidamide |
|---|---|
| PubChem CID | 172986304 |
| Molecular Formula | C23H30ClN7O2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N'-[[5-chloro-2-[(E)-3-oxo-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]prop-1-enyl]phenyl]methyl-(methylideneamino)amino]ethanimidamide |
| SMILES | C=NN(Cc1cc(Cl)ccc1/C=C/C(=O)N1CCCC(c2nc(C(C)C)no2)C1)/N=C(/C)N |
| InChI | InChI=1S/C23H30ClN7O2/c1-15(2)22-27-23(33-29-22)18-6-5-11-30(13-18)21(32)10-8-17-7-9-20(24)12-19(17)14-31(26-4)28-16(3)25/h7-10,12,15,18H,4-6,11,13-14H2,1-3H3,(H2,25,28)/b10-8+ |
| InChIKey | VWZOJSHBALVAFI-CSKARUKUSA-N |
| XLogP | 3.98 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|