C22H29ClN8 — CID 138631946
1-[5-chloro-2-[(1E)-3-[4-(5-methyltetrazol-1-yl)piperidin-1-yl]buta-1,3-dienyl]phenyl]-N-(methylideneamino)-N-(propan-2-ylideneamino)methanamine (PubChem CID 138631946) has the molecular formula C22H29ClN8 and a molecular weight of 440.98 g/mol. Its IUPAC name is 1-[5-chloro-2-[(1E)-3-[4-(5-methyltetrazol-1-yl)piperidin-1-yl]buta-1,3-dienyl]phenyl]-N-(methylideneamino)-N-(propan-2-ylideneamino)methanamine.
| Compound Name | 1-[5-chloro-2-[(1E)-3-[4-(5-methyltetrazol-1-yl)piperidin-1-yl]buta-1,3-dienyl]phenyl]-N-(methylideneamino)-N-(propan-2-ylideneamino)methanamine |
|---|---|
| PubChem CID | 138631946 |
| Molecular Formula | C22H29ClN8 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-[5-chloro-2-[(1E)-3-[4-(5-methyltetrazol-1-yl)piperidin-1-yl]buta-1,3-dienyl]phenyl]-N-(methylideneamino)-N-(propan-2-ylideneamino)methanamine |
| SMILES | C=NN(Cc1cc(Cl)ccc1/C=C/C(=C)N1CCC(n2nnnc2C)CC1)N=C(C)C |
| InChI | InChI=1S/C22H29ClN8/c1-16(2)26-30(24-5)15-20-14-21(23)9-8-19(20)7-6-17(3)29-12-10-22(11-13-29)31-18(4)25-27-28-31/h6-9,14,22H,3,5,10-13,15H2,1-2,4H3/b7-6+ |
| InChIKey | VSEPRSLKMAIHAU-VOTSOKGWSA-N |
| XLogP | 4.31 |
| TPSA | 74.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|