C23H34ClN9O2 — CID 138631953
N-[1-[(E)-3-[2-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]-4-chlorophenyl]prop-2-enoyl]piperidin-4-yl]-4-(2,3-dihydro-1H-triazol-4-yl)butanamide (PubChem CID 138631953) has the molecular formula C23H34ClN9O2 and a molecular weight of 504.04 g/mol. Its IUPAC name is N-[1-[(E)-3-[2-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]-4-chlorophenyl]prop-2-enoyl]piperidin-4-yl]-4-(2,3-dihydro-1H-triazol-4-yl)butanamide.
| Compound Name | N-[1-[(E)-3-[2-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]-4-chlorophenyl]prop-2-enoyl]piperidin-4-yl]-4-(2,3-dihydro-1H-triazol-4-yl)butanamide |
|---|---|
| PubChem CID | 138631953 |
| Molecular Formula | C23H34ClN9O2 |
| Molecular Weight | 504.04 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-[1-[(E)-3-[2-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]-4-chlorophenyl]prop-2-enoyl]piperidin-4-yl]-4-(2,3-dihydro-1H-triazol-4-yl)butanamide |
| SMILES | C/C(N)=N/N(N)Cc1cc(Cl)ccc1/C=C/C(=O)N1CCC(NC(=O)CCCC2=CNNN2)CC1 |
| InChI | InChI=1S/C23H34ClN9O2/c1-16(25)30-33(26)15-18-13-19(24)7-5-17(18)6-8-23(35)32-11-9-20(10-12-32)28-22(34)4-2-3-21-14-27-31-29-21/h5-8,13-14,20,27,29,31H,2-4,9-12,15,26H2,1H3,(H2,25,30)(H,28,34)/b8-6+ |
| InChIKey | JXQSHUKGENDRBG-SOFGYWHQSA-N |
| XLogP | 1.05 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.04 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|