C27H33ClN8O — CID 138632107
N'-[amino-[[5-chloro-2-[(E)-3-[4-[(1-methyl-3-phenylpyrazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methyl]amino]ethanimidamide (PubChem CID 138632107) has the molecular formula C27H33ClN8O and a molecular weight of 521.07 g/mol. Its IUPAC name is N'-[amino-[[5-chloro-2-[(E)-3-[4-[(1-methyl-3-phenylpyrazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methyl]amino]ethanimidamide.
| Compound Name | N'-[amino-[[5-chloro-2-[(E)-3-[4-[(1-methyl-3-phenylpyrazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 138632107 |
| Molecular Formula | C27H33ClN8O |
| Molecular Weight | 521.07 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | N'-[amino-[[5-chloro-2-[(E)-3-[4-[(1-methyl-3-phenylpyrazol-5-yl)methyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methyl]amino]ethanimidamide |
| SMILES | C/C(N)=N/N(N)Cc1cc(Cl)ccc1/C=C/C(=O)N1CCN(Cc2cc(-c3ccccc3)nn2C)CC1 |
| InChI | InChI=1S/C27H33ClN8O/c1-20(29)31-36(30)18-23-16-24(28)10-8-21(23)9-11-27(37)35-14-12-34(13-15-35)19-25-17-26(32-33(25)2)22-6-4-3-5-7-22/h3-11,16-17H,12-15,18-19,30H2,1-2H3,(H2,29,31)/b11-9+ |
| InChIKey | OKFZMSLTWOXZLT-PKNBQFBNSA-N |
| XLogP | 3.07 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.07 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|