C19H23N3O4 — CID 121098519
(E)-3-(3,4-dimethoxyphenyl)-1-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]prop-2-en-1-one (PubChem CID 121098519) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121098519 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CC(c3nc(C(C)C)no3)C2)cc1OC |
| InChI | InChI=1S/C19H23N3O4/c1-12(2)18-20-19(26-21-18)14-10-22(11-14)17(23)8-6-13-5-7-15(24-3)16(9-13)25-4/h5-9,12,14H,10-11H2,1-4H3/b8-6+ |
| InChIKey | AZCIALFTTQKTII-SOFGYWHQSA-N |
| XLogP | 2.85 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|