C16H18N4O3 — CID 121154804
(E)-3-(3,4-dimethoxyphenyl)-1-[3-(triazol-1-yl)azetidin-1-yl]prop-2-en-1-one (PubChem CID 121154804) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[3-(triazol-1-yl)azetidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[3-(triazol-1-yl)azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121154804 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[3-(triazol-1-yl)azetidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CC(n3ccnn3)C2)cc1OC |
| InChI | InChI=1S/C16H18N4O3/c1-22-14-5-3-12(9-15(14)23-2)4-6-16(21)19-10-13(11-19)20-8-7-17-18-20/h3-9,13H,10-11H2,1-2H3/b6-4+ |
| InChIKey | XUBKPTTXGSRCBN-GQCTYLIASA-N |
| XLogP | 1.39 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|