C18H22N4O2S — CID 172986379
N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzothiophene-2-carboxamide (PubChem CID 172986379) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 172986379 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzothiophene-2-carboxamide |
| SMILES | N/C(=N\O)c1ccc2cc(C(=O)NC[C@H]3CN4CCC3CC4)sc2c1 |
| InChI | InChI=1S/C18H22N4O2S/c19-17(21-24)13-2-1-12-7-16(25-15(12)8-13)18(23)20-9-14-10-22-5-3-11(14)4-6-22/h1-2,7-8,11,14,24H,3-6,9-10H2,(H2,19,21)(H,20,23)/t14-/m0/s1 |
| InChIKey | WDIUHKMWTFVPEK-AWEZNQCLSA-N |
| XLogP | 2.07 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|