C15H15ClN2O3S — CID 69106564
3-[[(6-chloro-1-benzothiophene-2-carbonyl)amino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 69106564) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is 3-[[(6-chloro-1-benzothiophene-2-carbonyl)amino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[[(6-chloro-1-benzothiophene-2-carbonyl)amino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69106564 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-[[(6-chloro-1-benzothiophene-2-carbonyl)amino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(NCC1CCN(C(=O)O)C1)c1cc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C15H15ClN2O3S/c16-11-2-1-10-5-13(22-12(10)6-11)14(19)17-7-9-3-4-18(8-9)15(20)21/h1-2,5-6,9H,3-4,7-8H2,(H,17,19)(H,20,21) |
| InChIKey | BFERCGHIDLVPCC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |