C40H68O2 — CID 172991159
(1S)-4-[(10E,14E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-10,14,17-trienyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 172991159) has the molecular formula C40H68O2 and a molecular weight of 580.98 g/mol. Its IUPAC name is (1S)-4-[(10E,14E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-10,14,17-trienyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1S)-4-[(10E,14E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-10,14,17-trienyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 172991159 |
| Molecular Formula | C40H68O2 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.52 |
| IUPAC Name | (1S)-4-[(10E,14E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-10,14,17-trienyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@H]1/C=C/C(C)/C=C/CC(C)/C=C/CCC(C)CCCC(C)CCC1=C(C)C[C@H](O)CC1(C)C |
| InChI | InChI=1S/C40H68O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11,13,15,19,21,23,25,29-32,35-37,41-42H,12,14,16-18,20,22,24,26-28H2,1-10H3/b15-11+,19-13+,23-21+/t29?,30?,31?,32?,35-,36-,37-/m0/s1 |
| InChIKey | OBCWHSOPTWKZGT-SEKFQUTJSA-N |
| XLogP | 11.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|