C24H34N4OS — CID 172991630
1,1-dimethyl-3-[4-[2-[(7R)-11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl]ethyl]cyclohexyl]urea (PubChem CID 172991630) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is 1,1-dimethyl-3-[4-[2-[(7R)-11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl]ethyl]cyclohexyl]urea.
| Compound Name | 1,1-dimethyl-3-[4-[2-[(7R)-11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl]ethyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 172991630 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1,1-dimethyl-3-[4-[2-[(7R)-11-thia-2,5-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-5-yl]ethyl]cyclohexyl]urea |
| SMILES | CN(C)C(=O)NC1CCC(CCN2CCN3c4cccc5scc(c45)C[C@@H]3C2)CC1 |
| InChI | InChI=1S/C24H34N4OS/c1-26(2)24(29)25-19-8-6-17(7-9-19)10-11-27-12-13-28-20(15-27)14-18-16-30-22-5-3-4-21(28)23(18)22/h3-5,16-17,19-20H,6-15H2,1-2H3,(H,25,29)/t17?,19?,20-/m1/s1 |
| InChIKey | NREVQZDRWLMTPD-LYBXBRPPSA-N |
| XLogP | 4.17 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |