C22H35ClN4O — CID 58264470
3-[4-[2-[4-(2-chloro-3-methylphenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1-dideuterioethyl]cyclohexyl]-1,1-dimethylurea (PubChem CID 58264470) has the molecular formula C22H35ClN4O and a molecular weight of 417.06 g/mol. Its IUPAC name is 3-[4-[2-[4-(2-chloro-3-methylphenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1-dideuterioethyl]cyclohexyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[2-[4-(2-chloro-3-methylphenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1-dideuterioethyl]cyclohexyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 58264470 |
| Molecular Formula | C22H35ClN4O |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 3-[4-[2-[4-(2-chloro-3-methylphenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1-dideuterioethyl]cyclohexyl]-1,1-dimethylurea |
| SMILES | [2H]C([2H])(CN1C([2H])([2H])C([2H])([2H])N(c2cccc(C)c2Cl)C([2H])([2H])C1([2H])[2H])C1CCC(NC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C22H35ClN4O/c1-17-5-4-6-20(21(17)23)27-15-13-26(14-16-27)12-11-18-7-9-19(10-8-18)24-22(28)25(2)3/h4-6,18-19H,7-16H2,1-3H3,(H,24,28)/i11D2,13D2,14D2,15D2,16D2 |
| InChIKey | KKFHAGDTEZJKCY-LZORLVNHSA-N |
| XLogP | 3.99 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |