C22H34ClFN4O — CID 156704255
3-[4-[2-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl]-1,1-dimethylurea (PubChem CID 156704255) has the molecular formula C22H34ClFN4O and a molecular weight of 424.99 g/mol. Its IUPAC name is 3-[4-[2-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[2-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 156704255 |
| Molecular Formula | C22H34ClFN4O |
| Molecular Weight | 424.99 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3-[4-[2-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl]-1,1-dimethylurea |
| SMILES | Cc1cccc(N2CCN(CCC3(F)CCC(NC(=O)N(C)C)CC3)CC2)c1Cl |
| InChI | InChI=1S/C22H34ClFN4O/c1-17-5-4-6-19(20(17)23)28-15-13-27(14-16-28)12-11-22(24)9-7-18(8-10-22)25-21(29)26(2)3/h4-6,18H,7-16H2,1-3H3,(H,25,29) |
| InChIKey | ZGAYNANCWWHKCU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |