C23H36N4O — CID 155035211
3-[5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1,1-dimethylurea (PubChem CID 155035211) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 3-[5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1,1-dimethylurea.
| Compound Name | 3-[5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 155035211 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 3-[5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1,1-dimethylurea |
| SMILES | Cc1cccc(N2CCN(C3CC4CC(NC(=O)N(C)C)CC4C3)CC2)c1C |
| InChI | InChI=1S/C23H36N4O/c1-16-6-5-7-22(17(16)2)27-10-8-26(9-11-27)21-14-18-12-20(13-19(18)15-21)24-23(28)25(3)4/h5-7,18-21H,8-15H2,1-4H3,(H,24,28) |
| InChIKey | YLMWKPWWHDIVOG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |