C10H12N2O2 — CID 172993047
2-(4-amino-2-pyridinyl)oxan-4-one (PubChem CID 172993047) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(4-amino-2-pyridinyl)oxan-4-one.
| Compound Name | 2-(4-amino-2-pyridinyl)oxan-4-one |
|---|---|
| PubChem CID | 172993047 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(4-amino-2-pyridinyl)oxan-4-one |
| SMILES | Nc1ccnc(C2CC(=O)CCO2)c1 |
| InChI | InChI=1S/C10H12N2O2/c11-7-1-3-12-9(5-7)10-6-8(13)2-4-14-10/h1,3,5,10H,2,4,6H2,(H2,11,12) |
| InChIKey | JUTCBRYMSXDPTI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |