About N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate
N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate (PubChem CID 172994049) has the molecular formula C7H18N2O5
and a molecular weight of 210.23 g/mol. Its IUPAC name is N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate.
Molecular Properties
| Compound Name | N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate |
| PubChem CID | 172994049 |
| Molecular Formula | C7H18N2O5 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate |
| SMILES | CC(=O)NC[C@H](N)OC(CO)CO.O |
| InChI | InChI=1S/C7H16N2O4.H2O/c1-5(12)9-2-7(8)13-6(3-10)4-11;/h6-7,10-11H,2-4,8H2,1H3,(H,9,12);1H2/t7-;/m1./s1 |
| InChIKey | MSGNPLYFKUXGQH-OGFXRTJISA-N |
| XLogP | -3.05 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate?
The IUPAC name of N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate (CID 172994049) is N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate.
What is the SMILES notation for N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate?
The canonical SMILES for N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate is CC(=O)NC[C@H](N)OC(CO)CO.O.
What is the InChIKey of N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate?
The InChIKey is MSGNPLYFKUXGQH-OGFXRTJISA-N. The full InChI is InChI=1S/C7H16N2O4.H2O/c1-5(12)9-2-7(8)13-6(3-10)4-11;/h6-7,10-11H,2-4,8H2,1H3,(H,9,12);1H2/t7-;/m1./s1.
What are the key properties of N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate?
N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate has a molecular weight of 210.23 g/mol, XLogP of -3.05, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate is sourced from PubChem (CID 172994049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).