C7H18N2O5 — CID 172994049
N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate (PubChem CID 172994049) has the molecular formula C7H18N2O5 and a molecular weight of 210.23 g/mol. Its IUPAC name is N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate.
| Compound Name | N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate |
|---|---|
| PubChem CID | 172994049 |
| Molecular Formula | C7H18N2O5 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(2R)-2-amino-2-(1,3-dihydroxypropan-2-yloxy)ethyl]acetamide;hydrate |
| SMILES | CC(=O)NC[C@H](N)OC(CO)CO.O |
| InChI | InChI=1S/C7H16N2O4.H2O/c1-5(12)9-2-7(8)13-6(3-10)4-11;/h6-7,10-11H,2-4,8H2,1H3,(H,9,12);1H2/t7-;/m1./s1 |
| InChIKey | MSGNPLYFKUXGQH-OGFXRTJISA-N |
| XLogP | -3.05 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|