C12H19N2NaO2S — CID 172995594
sodium;hydride;5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 172995594) has the molecular formula C12H19N2NaO2S and a molecular weight of 278.35 g/mol. Its IUPAC name is sodium;hydride;5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | sodium;hydride;5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 172995594 |
| Molecular Formula | C12H19N2NaO2S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | sodium;hydride;5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCC1(C(C)CCC)C(=O)NC(=S)NC1=O.[H-].[Na+] |
| InChI | InChI=1S/C12H18N2O2S.Na.H/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;;/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);;/q;+1;-1 |
| InChIKey | QIDAWWXWTPGPFI-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|