C12H18N2Na3O5S — CID 71308385
CID 71308385 (PubChem CID 71308385) has the molecular formula C12H18N2Na3O5S and a molecular weight of 371.32 g/mol.
| Compound Name | CID 71308385 |
|---|---|
| PubChem CID | 71308385 |
| Molecular Formula | C12H18N2Na3O5S |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | — |
| SMILES | CCCC(C)C1(CC)C(=O)NC(=S)NC1=O.O=C([O-])[O-].[Na+].[Na+].[Na] |
| InChI | InChI=1S/C11H18N2O2S.CH2O3.3Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;2-1(3)4;;;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);(H2,2,3,4);;;/q;;;2*+1/p-2 |
| InChIKey | GWTWYKYQEUEBPF-UHFFFAOYSA-L |
| XLogP | -7.47 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | -7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|