C17H22FN3O2 — CID 135571219
5-ethyl-2-(4-fluorophenyl)imino-5-[(2R)-pentan-2-yl]-1,3-diazinane-4,6-dione (PubChem CID 135571219) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 5-ethyl-2-(4-fluorophenyl)imino-5-[(2R)-pentan-2-yl]-1,3-diazinane-4,6-dione.
| Compound Name | 5-ethyl-2-(4-fluorophenyl)imino-5-[(2R)-pentan-2-yl]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 135571219 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 5-ethyl-2-(4-fluorophenyl)imino-5-[(2R)-pentan-2-yl]-1,3-diazinane-4,6-dione |
| SMILES | CCC[C@@H](C)C1(CC)C(=O)NC(=Nc2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C17H22FN3O2/c1-4-6-11(3)17(5-2)14(22)20-16(21-15(17)23)19-13-9-7-12(18)8-10-13/h7-11H,4-6H2,1-3H3,(H2,19,20,21,22,23)/t11-/m1/s1 |
| InChIKey | REOCKKDOWQLIIZ-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|