C13H19N2NaO2S — CID 137321619
sodium 1-methyl-4,6-dioxo-5-pentan-2-yl-5-prop-2-enylpyrimidine-2-thiolate (PubChem CID 137321619) has the molecular formula C13H19N2NaO2S and a molecular weight of 290.36 g/mol. Its IUPAC name is sodium 1-methyl-4,6-dioxo-5-pentan-2-yl-5-prop-2-enylpyrimidine-2-thiolate.
| Compound Name | sodium 1-methyl-4,6-dioxo-5-pentan-2-yl-5-prop-2-enylpyrimidine-2-thiolate |
|---|---|
| PubChem CID | 137321619 |
| Molecular Formula | C13H19N2NaO2S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | sodium 1-methyl-4,6-dioxo-5-pentan-2-yl-5-prop-2-enylpyrimidine-2-thiolate |
| SMILES | C=CCC1(C(C)CCC)C(=O)N=C([S-])N(C)C1=O.[Na+] |
| InChI | InChI=1S/C13H20N2O2S.Na/c1-5-7-9(3)13(8-6-2)10(16)14-12(18)15(4)11(13)17;/h6,9H,2,5,7-8H2,1,3-4H3,(H,14,16,18);/q;+1/p-1 |
| InChIKey | MCHBXLVNDNWGHJ-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|