C12H17N3O4 — CID 10706919
4-(2-amino-4,6-dioxo-5-prop-2-enyl-1H-pyrimidin-5-yl)pentanoic acid (PubChem CID 10706919) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-(2-amino-4,6-dioxo-5-prop-2-enyl-1H-pyrimidin-5-yl)pentanoic acid.
| Compound Name | 4-(2-amino-4,6-dioxo-5-prop-2-enyl-1H-pyrimidin-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 10706919 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-(2-amino-4,6-dioxo-5-prop-2-enyl-1H-pyrimidin-5-yl)pentanoic acid |
| SMILES | C=CCC1(C(C)CCC(=O)O)C(=O)N=C(N)NC1=O |
| InChI | InChI=1S/C12H17N3O4/c1-3-6-12(7(2)4-5-8(16)17)9(18)14-11(13)15-10(12)19/h3,7H,1,4-6H2,2H3,(H,16,17)(H3,13,14,15,18,19) |
| InChIKey | JPDZUYRHYVPCEK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|