C18H35AsN2O5P+ — CID 172997224
[(3R)-4-[[(2S)-2-[(2S)-2-aminopropanoyl]arsanyl-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium (PubChem CID 172997224) has the molecular formula C18H35AsN2O5P+ and a molecular weight of 465.38 g/mol. Its IUPAC name is [(3R)-4-[[(2S)-2-[(2S)-2-aminopropanoyl]arsanyl-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium.
| Compound Name | [(3R)-4-[[(2S)-2-[(2S)-2-aminopropanoyl]arsanyl-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 172997224 |
| Molecular Formula | C18H35AsN2O5P+ |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [(3R)-4-[[(2S)-2-[(2S)-2-aminopropanoyl]arsanyl-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium |
| SMILES | CC(C)[C@H]([AsH]C(=O)[C@H](C)N)C(=O)NC[C@H](O)CC(C1CCCCC1)[P+](=O)O |
| InChI | InChI=1S/C18H34AsN2O5P/c1-11(2)16(19-17(23)12(3)20)18(24)21-10-14(22)9-15(27(25)26)13-7-5-4-6-8-13/h11-16,19,22H,4-10,20H2,1-3H3,(H-,21,24,25,26)/p+1/t12-,14+,15?,16-/m0/s1 |
| InChIKey | RIUXBORTBAVCRD-WRFLBERSSA-O |
| XLogP | 1.29 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|