C12H24N2O4P+ — CID 66594747
[(3R)-4-[(2-aminoacetyl)amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium (PubChem CID 66594747) has the molecular formula C12H24N2O4P+ and a molecular weight of 291.31 g/mol. Its IUPAC name is [(3R)-4-[(2-aminoacetyl)amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium.
| Compound Name | [(3R)-4-[(2-aminoacetyl)amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 66594747 |
| Molecular Formula | C12H24N2O4P+ |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [(3R)-4-[(2-aminoacetyl)amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium |
| SMILES | NCC(=O)NC[C@H](O)CC(C1CCCCC1)[P+](=O)O |
| InChI | InChI=1S/C12H23N2O4P/c13-7-12(16)14-8-10(15)6-11(19(17)18)9-4-2-1-3-5-9/h9-11,15H,1-8,13H2,(H-,14,16,17,18)/p+1/t10-,11?/m1/s1 |
| InChIKey | ROFDETZCOVOMPB-NFJWQWPMSA-O |
| XLogP | 0.50 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|