C15H18F3N5O2 — CID 173001681
N-[[1-ethyl-4-(oxan-4-ylamino)-6-(trifluoromethyl)pyrazolo[3,4-b]pyridin-5-yl]methylidene]hydroxylamine (PubChem CID 173001681) has the molecular formula C15H18F3N5O2 and a molecular weight of 357.34 g/mol. Its IUPAC name is N-[[1-ethyl-4-(oxan-4-ylamino)-6-(trifluoromethyl)pyrazolo[3,4-b]pyridin-5-yl]methylidene]hydroxylamine.
| Compound Name | N-[[1-ethyl-4-(oxan-4-ylamino)-6-(trifluoromethyl)pyrazolo[3,4-b]pyridin-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 173001681 |
| Molecular Formula | C15H18F3N5O2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[[1-ethyl-4-(oxan-4-ylamino)-6-(trifluoromethyl)pyrazolo[3,4-b]pyridin-5-yl]methylidene]hydroxylamine |
| SMILES | CCn1ncc2c(NC3CCOCC3)c(C=NO)c(C(F)(F)F)nc21 |
| InChI | InChI=1S/C15H18F3N5O2/c1-2-23-14-11(7-19-23)12(21-9-3-5-25-6-4-9)10(8-20-24)13(22-14)15(16,17)18/h7-9,24H,2-6H2,1H3,(H,21,22) |
| InChIKey | QLIRXOKMCIPFDZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|