C23H29N5O2 — CID 11682922
N-benzyl-1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 11682922) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-benzyl-1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-benzyl-1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11682922 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-benzyl-1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H29N5O2/c1-3-19-20(23(29)24-14-16-8-6-5-7-9-16)21(26-17-10-12-30-13-11-17)18-15-25-28(4-2)22(18)27-19/h5-9,15,17H,3-4,10-14H2,1-2H3,(H,24,29)(H,26,27) |
| InChIKey | CRQGNCVMKRLKMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |