C22H29ClN4O4S — CID 87243328
benzenesulfonic acid;5-(chloromethyl)-1,6-diethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 87243328) has the molecular formula C22H29ClN4O4S and a molecular weight of 481.02 g/mol. Its IUPAC name is benzenesulfonic acid;5-(chloromethyl)-1,6-diethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | benzenesulfonic acid;5-(chloromethyl)-1,6-diethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 87243328 |
| Molecular Formula | C22H29ClN4O4S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | benzenesulfonic acid;5-(chloromethyl)-1,6-diethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CCl.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C16H23ClN4O.C6H6O3S/c1-3-14-12(9-17)15(19-11-5-7-22-8-6-11)13-10-18-21(4-2)16(13)20-14;7-10(8,9)6-4-2-1-3-5-6/h10-11H,3-9H2,1-2H3,(H,19,20);1-5H,(H,7,8,9) |
| InChIKey | HWYURQSTCLUIRS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|