C19H26N6O3 — CID 89190843
1-ethyl-6-methyl-N'-(2-methylprop-2-enoyl)-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide (PubChem CID 89190843) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-ethyl-6-methyl-N'-(2-methylprop-2-enoyl)-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide.
| Compound Name | 1-ethyl-6-methyl-N'-(2-methylprop-2-enoyl)-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide |
|---|---|
| PubChem CID | 89190843 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-ethyl-6-methyl-N'-(2-methylprop-2-enoyl)-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide |
| SMILES | C=C(C)C(=O)NNC(=O)c1c(C)nc2c(cnn2CC)c1NC1CCOCC1 |
| InChI | InChI=1S/C19H26N6O3/c1-5-25-17-14(10-20-25)16(22-13-6-8-28-9-7-13)15(12(4)21-17)19(27)24-23-18(26)11(2)3/h10,13H,2,5-9H2,1,3-4H3,(H,21,22)(H,23,26)(H,24,27) |
| InChIKey | TUBGOEYCRJUNFK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|