C15H27N3Si — CID 173002891
3-bis(prop-2-enylamino)silyl-N,N-bis(prop-2-enyl)prop-1-en-1-amine (PubChem CID 173002891) has the molecular formula C15H27N3Si and a molecular weight of 277.49 g/mol. Its IUPAC name is 3-bis(prop-2-enylamino)silyl-N,N-bis(prop-2-enyl)prop-1-en-1-amine.
| Compound Name | 3-bis(prop-2-enylamino)silyl-N,N-bis(prop-2-enyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 173002891 |
| Molecular Formula | C15H27N3Si |
| Molecular Weight | 277.49 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3-bis(prop-2-enylamino)silyl-N,N-bis(prop-2-enyl)prop-1-en-1-amine |
| SMILES | C=CCN[SiH](CC=CN(CC=C)CC=C)NCC=C |
| InChI | InChI=1S/C15H27N3Si/c1-5-10-16-19(17-11-6-2)15-9-14-18(12-7-3)13-8-4/h5-9,14,16-17,19H,1-4,10-13,15H2 |
| InChIKey | DMPODBOUUFGDJT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|