C12H20N2 — CID 173094212
1-N,1-N',1-N'-tris(prop-2-enyl)prop-2-ene-1,1-diamine (PubChem CID 173094212) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N,1-N',1-N'-tris(prop-2-enyl)prop-2-ene-1,1-diamine.
| Compound Name | 1-N,1-N',1-N'-tris(prop-2-enyl)prop-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 173094212 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N,1-N',1-N'-tris(prop-2-enyl)prop-2-ene-1,1-diamine |
| SMILES | C=CCNC(C=C)N(CC=C)CC=C |
| InChI | InChI=1S/C12H20N2/c1-5-9-13-12(8-4)14(10-6-2)11-7-3/h5-8,12-13H,1-4,9-11H2 |
| InChIKey | UDNNJLCHRAWLHU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|