C5H8F3N — CID 175323275
N-(1,2,2-trifluoroethyl)prop-2-en-1-amine (PubChem CID 175323275) has the molecular formula C5H8F3N and a molecular weight of 139.12 g/mol. Its IUPAC name is N-(1,2,2-trifluoroethyl)prop-2-en-1-amine.
| Compound Name | N-(1,2,2-trifluoroethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 175323275 |
| Molecular Formula | C5H8F3N |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | N-(1,2,2-trifluoroethyl)prop-2-en-1-amine |
| SMILES | C=CCNC(F)C(F)F |
| InChI | InChI=1S/C5H8F3N/c1-2-3-9-5(8)4(6)7/h2,4-5,9H,1,3H2 |
| InChIKey | WTVPRLAFBOWEGT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|