About N-(1,2,2-trifluoroethyl)prop-2-en-1-amine
N-(1,2,2-trifluoroethyl)prop-2-en-1-amine (PubChem CID 175323275) has the molecular formula C5H8F3N
and a molecular weight of 139.12 g/mol. Its IUPAC name is N-(1,2,2-trifluoroethyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-(1,2,2-trifluoroethyl)prop-2-en-1-amine |
| PubChem CID | 175323275 |
| Molecular Formula | C5H8F3N |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | N-(1,2,2-trifluoroethyl)prop-2-en-1-amine |
| SMILES | C=CCNC(F)C(F)F |
| InChI | InChI=1S/C5H8F3N/c1-2-3-9-5(8)4(6)7/h2,4-5,9H,1,3H2 |
| InChIKey | WTVPRLAFBOWEGT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,2,2-trifluoroethyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2,2-trifluoroethyl)prop-2-en-1-amine?
The IUPAC name of N-(1,2,2-trifluoroethyl)prop-2-en-1-amine (CID 175323275) is N-(1,2,2-trifluoroethyl)prop-2-en-1-amine.
What is the SMILES notation for N-(1,2,2-trifluoroethyl)prop-2-en-1-amine?
The canonical SMILES for N-(1,2,2-trifluoroethyl)prop-2-en-1-amine is C=CCNC(F)C(F)F.
What is the InChIKey of N-(1,2,2-trifluoroethyl)prop-2-en-1-amine?
The InChIKey is WTVPRLAFBOWEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3N/c1-2-3-9-5(8)4(6)7/h2,4-5,9H,1,3H2.
What are the key properties of N-(1,2,2-trifluoroethyl)prop-2-en-1-amine?
N-(1,2,2-trifluoroethyl)prop-2-en-1-amine has a molecular weight of 139.12 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2,2-trifluoroethyl)prop-2-en-1-amine is sourced from PubChem (CID 175323275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).