C5H12BrNO3 — CID 175081844
2-(prop-2-enylamino)ethane-1,1,2-triol;hydrobromide (PubChem CID 175081844) has the molecular formula C5H12BrNO3 and a molecular weight of 214.06 g/mol. Its IUPAC name is 2-(prop-2-enylamino)ethane-1,1,2-triol;hydrobromide.
| Compound Name | 2-(prop-2-enylamino)ethane-1,1,2-triol;hydrobromide |
|---|---|
| PubChem CID | 175081844 |
| Molecular Formula | C5H12BrNO3 |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 2-(prop-2-enylamino)ethane-1,1,2-triol;hydrobromide |
| SMILES | Br.C=CCNC(O)C(O)O |
| InChI | InChI=1S/C5H11NO3.BrH/c1-2-3-6-4(7)5(8)9;/h2,4-9H,1,3H2;1H |
| InChIKey | MWQFXSPLRFPLLX-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|