About bis(4-ethenylhepta-1,6-dien-4-yl)tin
bis(4-ethenylhepta-1,6-dien-4-yl)tin (PubChem CID 173002899) has the molecular formula C18H26Sn
and a molecular weight of 361.12 g/mol. Its IUPAC name is bis(4-ethenylhepta-1,6-dien-4-yl)tin.
Molecular Properties
| Compound Name | bis(4-ethenylhepta-1,6-dien-4-yl)tin |
| PubChem CID | 173002899 |
| Molecular Formula | C18H26Sn |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | bis(4-ethenylhepta-1,6-dien-4-yl)tin |
| SMILES | C=CCC(C=C)(CC=C)[Sn]C(C=C)(CC=C)CC=C |
| InChI | InChI=1S/2C9H13.Sn/c2*1-4-7-9(6-3)8-5-2;/h2*4-6H,1-3,7-8H2; |
| InChIKey | HYKVXORZBMMKGS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(4-ethenylhepta-1,6-dien-4-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ethenylhepta-1,6-dien-4-yl)tin?
The IUPAC name of bis(4-ethenylhepta-1,6-dien-4-yl)tin (CID 173002899) is bis(4-ethenylhepta-1,6-dien-4-yl)tin.
What is the SMILES notation for bis(4-ethenylhepta-1,6-dien-4-yl)tin?
The canonical SMILES for bis(4-ethenylhepta-1,6-dien-4-yl)tin is C=CCC(C=C)(CC=C)[Sn]C(C=C)(CC=C)CC=C.
What is the InChIKey of bis(4-ethenylhepta-1,6-dien-4-yl)tin?
The InChIKey is HYKVXORZBMMKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H13.Sn/c2*1-4-7-9(6-3)8-5-2;/h2*4-6H,1-3,7-8H2;.
What are the key properties of bis(4-ethenylhepta-1,6-dien-4-yl)tin?
bis(4-ethenylhepta-1,6-dien-4-yl)tin has a molecular weight of 361.12 g/mol, XLogP of 5.68, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ethenylhepta-1,6-dien-4-yl)tin is sourced from PubChem (CID 173002899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).