C20H17Cl3N4 — CID 173003387
1,3,5-tris(4-chlorophenyl)tetrazinane (PubChem CID 173003387) has the molecular formula C20H17Cl3N4 and a molecular weight of 419.74 g/mol. Its IUPAC name is 1,3,5-tris(4-chlorophenyl)tetrazinane.
| Compound Name | 1,3,5-tris(4-chlorophenyl)tetrazinane |
|---|---|
| PubChem CID | 173003387 |
| Molecular Formula | C20H17Cl3N4 |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 1,3,5-tris(4-chlorophenyl)tetrazinane |
| SMILES | Clc1ccc(C2CN(c3ccc(Cl)cc3)NN(c3ccc(Cl)cc3)N2)cc1 |
| InChI | InChI=1S/C20H17Cl3N4/c21-15-3-1-14(2-4-15)20-13-26(18-9-5-16(22)6-10-18)25-27(24-20)19-11-7-17(23)8-12-19/h1-12,20,24-25H,13H2 |
| InChIKey | WRLHEEJJWGJPNS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |