About 3-(dodecylamino)propane-1,1-diol;hydrochloride
3-(dodecylamino)propane-1,1-diol;hydrochloride (PubChem CID 173003690) has the molecular formula C15H34ClNO2
and a molecular weight of 295.89 g/mol. Its IUPAC name is 3-(dodecylamino)propane-1,1-diol;hydrochloride.
Molecular Properties
| Compound Name | 3-(dodecylamino)propane-1,1-diol;hydrochloride |
| PubChem CID | 173003690 |
| Molecular Formula | C15H34ClNO2 |
| Molecular Weight | 295.89 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 3-(dodecylamino)propane-1,1-diol;hydrochloride |
| SMILES | CCCCCCCCCCCCNCCC(O)O.Cl |
| InChI | InChI=1S/C15H33NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-13-16-14-12-15(17)18;/h15-18H,2-14H2,1H3;1H |
| InChIKey | JXOJJLAAAUVLKN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(dodecylamino)propane-1,1-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dodecylamino)propane-1,1-diol;hydrochloride?
The IUPAC name of 3-(dodecylamino)propane-1,1-diol;hydrochloride (CID 173003690) is 3-(dodecylamino)propane-1,1-diol;hydrochloride.
What is the SMILES notation for 3-(dodecylamino)propane-1,1-diol;hydrochloride?
The canonical SMILES for 3-(dodecylamino)propane-1,1-diol;hydrochloride is CCCCCCCCCCCCNCCC(O)O.Cl.
What is the InChIKey of 3-(dodecylamino)propane-1,1-diol;hydrochloride?
The InChIKey is JXOJJLAAAUVLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-13-16-14-12-15(17)18;/h15-18H,2-14H2,1H3;1H.
What are the key properties of 3-(dodecylamino)propane-1,1-diol;hydrochloride?
3-(dodecylamino)propane-1,1-diol;hydrochloride has a molecular weight of 295.89 g/mol, XLogP of 3.62, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dodecylamino)propane-1,1-diol;hydrochloride is sourced from PubChem (CID 173003690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).