About 3-(nonadecylamino)propane-1,1-diol;hydrochloride
3-(nonadecylamino)propane-1,1-diol;hydrochloride (PubChem CID 173363692) has the molecular formula C22H48ClNO2
and a molecular weight of 394.08 g/mol. Its IUPAC name is 3-(nonadecylamino)propane-1,1-diol;hydrochloride.
Molecular Properties
| Compound Name | 3-(nonadecylamino)propane-1,1-diol;hydrochloride |
| PubChem CID | 173363692 |
| Molecular Formula | C22H48ClNO2 |
| Molecular Weight | 394.08 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | 3-(nonadecylamino)propane-1,1-diol;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCCCNCCC(O)O.Cl |
| InChI | InChI=1S/C22H47NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23-21-19-22(24)25;/h22-25H,2-21H2,1H3;1H |
| InChIKey | OWHJEODTPYJLAG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.08 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(nonadecylamino)propane-1,1-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(nonadecylamino)propane-1,1-diol;hydrochloride?
The IUPAC name of 3-(nonadecylamino)propane-1,1-diol;hydrochloride (CID 173363692) is 3-(nonadecylamino)propane-1,1-diol;hydrochloride.
What is the SMILES notation for 3-(nonadecylamino)propane-1,1-diol;hydrochloride?
The canonical SMILES for 3-(nonadecylamino)propane-1,1-diol;hydrochloride is CCCCCCCCCCCCCCCCCCCNCCC(O)O.Cl.
What is the InChIKey of 3-(nonadecylamino)propane-1,1-diol;hydrochloride?
The InChIKey is OWHJEODTPYJLAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H47NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23-21-19-22(24)25;/h22-25H,2-21H2,1H3;1H.
What are the key properties of 3-(nonadecylamino)propane-1,1-diol;hydrochloride?
3-(nonadecylamino)propane-1,1-diol;hydrochloride has a molecular weight of 394.08 g/mol, XLogP of 6.35, 21 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nonadecylamino)propane-1,1-diol;hydrochloride is sourced from PubChem (CID 173363692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).