C20H41NO3 — CID 87068209
1-(3,3-dihydroxypropylamino)heptadecan-4-one (PubChem CID 87068209) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is 1-(3,3-dihydroxypropylamino)heptadecan-4-one.
| Compound Name | 1-(3,3-dihydroxypropylamino)heptadecan-4-one |
|---|---|
| PubChem CID | 87068209 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | 1-(3,3-dihydroxypropylamino)heptadecan-4-one |
| SMILES | CCCCCCCCCCCCCC(=O)CCCNCCC(O)O |
| InChI | InChI=1S/C20H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-14-19(22)15-13-17-21-18-16-20(23)24/h20-21,23-24H,2-18H2,1H3 |
| InChIKey | IAGYBBNZTFDHOK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|