About dihydroxy(oxo)silane;silane
dihydroxy(oxo)silane;silane (PubChem CID 173005050) has the molecular formula H6O3Si2
and a molecular weight of 110.22 g/mol. Its IUPAC name is dihydroxy(oxo)silane;silane.
Molecular Properties
| Compound Name | dihydroxy(oxo)silane;silane |
| PubChem CID | 173005050 |
| Molecular Formula | H6O3Si2 |
| Molecular Weight | 110.22 g/mol |
| Exact Mass | 109.99 |
| IUPAC Name | dihydroxy(oxo)silane;silane |
| SMILES | O=[Si](O)O.[SiH4] |
| InChI | InChI=1S/H2O3Si.H4Si/c1-4(2)3;/h1-2H;1H4 |
| InChIKey | IJBBNOWNICLWFF-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.22 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)silane;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)silane;silane?
The IUPAC name of dihydroxy(oxo)silane;silane (CID 173005050) is dihydroxy(oxo)silane;silane.
What is the SMILES notation for dihydroxy(oxo)silane;silane?
The canonical SMILES for dihydroxy(oxo)silane;silane is O=[Si](O)O.[SiH4].
What is the InChIKey of dihydroxy(oxo)silane;silane?
The InChIKey is IJBBNOWNICLWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3Si.H4Si/c1-4(2)3;/h1-2H;1H4.
What are the key properties of dihydroxy(oxo)silane;silane?
dihydroxy(oxo)silane;silane has a molecular weight of 110.22 g/mol, XLogP of -3.07, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)silane;silane is sourced from PubChem (CID 173005050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).