About cobalt;bis(dihydroxy(oxo)silane)
cobalt;bis(dihydroxy(oxo)silane) (PubChem CID 173415192) has the molecular formula H4CoO6Si2
and a molecular weight of 215.13 g/mol. Its IUPAC name is cobalt;bis(dihydroxy(oxo)silane).
Molecular Properties
| Compound Name | cobalt;bis(dihydroxy(oxo)silane) |
| PubChem CID | 173415192 |
| Molecular Formula | H4CoO6Si2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 214.89 |
| IUPAC Name | cobalt;bis(dihydroxy(oxo)silane) |
| SMILES | O=[Si](O)O.O=[Si](O)O.[Co] |
| InChI | InChI=1S/Co.2H2O3Si/c;2*1-4(2)3/h;2*1-2H |
| InChIKey | UNQGJQJPSGYZRL-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(dihydroxy(oxo)silane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(dihydroxy(oxo)silane)?
The IUPAC name of cobalt;bis(dihydroxy(oxo)silane) (CID 173415192) is cobalt;bis(dihydroxy(oxo)silane).
What is the SMILES notation for cobalt;bis(dihydroxy(oxo)silane)?
The canonical SMILES for cobalt;bis(dihydroxy(oxo)silane) is O=[Si](O)O.O=[Si](O)O.[Co].
What is the InChIKey of cobalt;bis(dihydroxy(oxo)silane)?
The InChIKey is UNQGJQJPSGYZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/Co.2H2O3Si/c;2*1-4(2)3/h;2*1-2H.
What are the key properties of cobalt;bis(dihydroxy(oxo)silane)?
cobalt;bis(dihydroxy(oxo)silane) has a molecular weight of 215.13 g/mol, XLogP of -3.23, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(dihydroxy(oxo)silane) is sourced from PubChem (CID 173415192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).