About dihydroxy(oxo)silane;yttrium
dihydroxy(oxo)silane;yttrium (PubChem CID 173082239) has the molecular formula H2O3SiY
and a molecular weight of 167.01 g/mol. Its IUPAC name is dihydroxy(oxo)silane;yttrium.
Molecular Properties
| Compound Name | dihydroxy(oxo)silane;yttrium |
| PubChem CID | 173082239 |
| Molecular Formula | H2O3SiY |
| Molecular Weight | 167.01 g/mol |
| Exact Mass | 166.88 |
| IUPAC Name | dihydroxy(oxo)silane;yttrium |
| SMILES | O=[Si](O)O.[Y] |
| InChI | InChI=1S/H2O3Si.Y/c1-4(2)3;/h1-2H; |
| InChIKey | FXUXKLXBFPIEOO-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.01 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)silane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)silane;yttrium?
The IUPAC name of dihydroxy(oxo)silane;yttrium (CID 173082239) is dihydroxy(oxo)silane;yttrium.
What is the SMILES notation for dihydroxy(oxo)silane;yttrium?
The canonical SMILES for dihydroxy(oxo)silane;yttrium is O=[Si](O)O.[Y].
What is the InChIKey of dihydroxy(oxo)silane;yttrium?
The InChIKey is FXUXKLXBFPIEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3Si.Y/c1-4(2)3;/h1-2H;.
What are the key properties of dihydroxy(oxo)silane;yttrium?
dihydroxy(oxo)silane;yttrium has a molecular weight of 167.01 g/mol, XLogP of -1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)silane;yttrium is sourced from PubChem (CID 173082239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).