C14H32N2O2Si — CID 173005167
1,1-diethoxyethyl-(1,3-diethyl-1,3-diazinan-5-yl)silane (PubChem CID 173005167) has the molecular formula C14H32N2O2Si and a molecular weight of 288.51 g/mol. Its IUPAC name is 1,1-diethoxyethyl-(1,3-diethyl-1,3-diazinan-5-yl)silane.
| Compound Name | 1,1-diethoxyethyl-(1,3-diethyl-1,3-diazinan-5-yl)silane |
|---|---|
| PubChem CID | 173005167 |
| Molecular Formula | C14H32N2O2Si |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 1,1-diethoxyethyl-(1,3-diethyl-1,3-diazinan-5-yl)silane |
| SMILES | CCOC(C)(OCC)[SiH2]C1CN(CC)CN(CC)C1 |
| InChI | InChI=1S/C14H32N2O2Si/c1-6-15-10-13(11-16(7-2)12-15)19-14(5,17-8-3)18-9-4/h13H,6-12,19H2,1-5H3 |
| InChIKey | OMKWAKGMNHMXQE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|